Difference between revisions of "CPD-11665"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Guanine37-in-tRNA == * common-name: ** a guanine37 in trna == Reaction(s) known to consume the compound == * RXN-12458 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-11665 == * common-name: ** serotonin o-sulfate * smiles: ** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2)) * inchi-key: ** jfwysggscoobgk-uh...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11665 == |
* common-name: | * common-name: | ||
− | ** | + | ** serotonin o-sulfate |
+ | * smiles: | ||
+ | ** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2)) | ||
+ | * inchi-key: | ||
+ | ** jfwysggscoobgk-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 256.276 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10777]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=serotonin o-sulfate}} |
+ | {{#set: inchi-key=inchikey=jfwysggscoobgk-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=256.276}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-11665
- common-name:
- serotonin o-sulfate
- smiles:
- c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2))
- inchi-key:
- jfwysggscoobgk-uhfffaoysa-n
- molecular-weight:
- 256.276