Difference between revisions of "PROTEIN-C-TERMINAL-S-ETC-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FERULOYL-COA == * common-name: ** feruloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c...")
(Created page with "Category:metabolite == Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE == * common-name: ** a [protein] c-terminal s-farnesyl-l-cysteine == Reaction(s) known to consume the c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FERULOYL-COA ==
+
== Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE ==
 
* common-name:
 
* common-name:
** feruloyl-coa
+
** a [protein] c-terminal s-farnesyl-l-cysteine
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** gbxzvjqqdajgso-nbxnmegssa-j
 
* molecular-weight:
 
** 939.674
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1106]]
+
* [[2.1.1.100-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.2.1.34-RXN]]
+
* [[RXN-11698]]
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+
* [[RXN-8409]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=feruloyl-coa}}
+
{{#set: common-name=a [protein] c-terminal s-farnesyl-l-cysteine}}
{{#set: inchi-key=inchikey=gbxzvjqqdajgso-nbxnmegssa-j}}
 
{{#set: molecular-weight=939.674}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE

  • common-name:
    • a [protein] c-terminal s-farnesyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein] c-terminal s-farnesyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.