Difference between revisions of "IMIDAZOLE-ACETOL-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13576 == * common-name: ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate * smiles: ** cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)...") |
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-ACETOL-P == * common-name: ** imidazole acetol-phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o) * inchi-key: ** ycffms...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite IMIDAZOLE-ACETOL-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** imidazole acetol-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ycffmsolumramd-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 218.105 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[HISTAMINOTRANS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[HISTAMINOTRANS-RXN]] | ||
| + | * [[IGPD]] | ||
| + | * [[IMIDPHOSDEHYD-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=imidazole acetol-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ycffmsolumramd-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=218.105}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite IMIDAZOLE-ACETOL-P
- common-name:
- imidazole acetol-phosphate
- smiles:
- c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
- inchi-key:
- ycffmsolumramd-uhfffaoysa-l
- molecular-weight:
- 218.105
