Difference between revisions of "MANNITOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-THREONINE-O-3-PHOSPHATE == * common-name: ** l-threonine 3-o-phosphate * smiles: ** cc(op([o-])([o-])=o)c([n+])c([o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite MANNITOL == * common-name: ** d-mannitol * smiles: ** c(c(c(c(c(co)o)o)o)o)o * inchi-key: ** fbpfztcfmrresa-kvtdhhqdsa-n * molecular-weig...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MANNITOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-mannitol |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(c(c(c(co)o)o)o)o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fbpfztcfmrresa-kvtdhhqdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 182.173 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[MANNITOL-2-DEHYDROGENASE-RXN]] |
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[MANNITOL-1-PHOSPHATASE-RXN]] | ||
| + | * [[MANNITOL-2-DEHYDROGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-mannitol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fbpfztcfmrresa-kvtdhhqdsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=182.173}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite MANNITOL
- common-name:
- d-mannitol
- smiles:
- c(c(c(c(c(co)o)o)o)o)o
- inchi-key:
- fbpfztcfmrresa-kvtdhhqdsa-n
- molecular-weight:
- 182.173
