Difference between revisions of "CPD-16618"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12724 == * common-name: ** baicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3))) * inchi-key: ** fxnfhkrtjbstcs...") |
(Created page with "Category:metabolite == Metabolite CPD-16618 == * common-name: ** l-malic semialdehyde * smiles: ** c(c(=o)[o-])c(o)[ch]=o * inchi-key: ** qwhdxiuuxwgqme-gsvougtgsa-m * mol...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-16618 == |
* common-name: | * common-name: | ||
− | ** | + | ** l-malic semialdehyde |
* smiles: | * smiles: | ||
− | ** | + | ** c(c(=o)[o-])c(o)[ch]=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qwhdxiuuxwgqme-gsvougtgsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 117.081 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-6002]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-malic semialdehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qwhdxiuuxwgqme-gsvougtgsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=117.081}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-16618
- common-name:
- l-malic semialdehyde
- smiles:
- c(c(=o)[o-])c(o)[ch]=o
- inchi-key:
- qwhdxiuuxwgqme-gsvougtgsa-m
- molecular-weight:
- 117.081