Difference between revisions of "D-ERYTHRULOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13014 == * common-name: ** tributyrin * smiles: ** cccc(occ(oc(ccc)=o)coc(ccc)=o)=o * inchi-key: ** uyxtwwcetriedr-uhfffaoysa-n * mol...")
(Created page with "Category:metabolite == Metabolite D-ERYTHRULOSE == * common-name: ** d-erythrulose * smiles: ** c(o)c(o)c(=o)co * inchi-key: ** uqphvqvxlprncx-gsvougtgsa-n * molecular-wei...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13014 ==
+
== Metabolite D-ERYTHRULOSE ==
 
* common-name:
 
* common-name:
** tributyrin
+
** d-erythrulose
 
* smiles:
 
* smiles:
** cccc(occ(oc(ccc)=o)coc(ccc)=o)=o
+
** c(o)c(o)c(=o)co
 
* inchi-key:
 
* inchi-key:
** uyxtwwcetriedr-uhfffaoysa-n
+
** uqphvqvxlprncx-gsvougtgsa-n
 
* molecular-weight:
 
* molecular-weight:
** 302.367
+
** 120.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12086]]
+
* [[ERYTHRULOSE-REDUCTASE-RXN]]
 +
* [[RXN-17773]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ERYTHRULOSE-REDUCTASE-RXN]]
 +
* [[RXN-17773]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tributyrin}}
+
{{#set: common-name=d-erythrulose}}
{{#set: inchi-key=inchikey=uyxtwwcetriedr-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=uqphvqvxlprncx-gsvougtgsa-n}}
{{#set: molecular-weight=302.367}}
+
{{#set: molecular-weight=120.105}}

Latest revision as of 11:13, 18 March 2021

Metabolite D-ERYTHRULOSE

  • common-name:
    • d-erythrulose
  • smiles:
    • c(o)c(o)c(=o)co
  • inchi-key:
    • uqphvqvxlprncx-gsvougtgsa-n
  • molecular-weight:
    • 120.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality