Difference between revisions of "PWY-7089"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-129 CPD1F-129] == * common-name: ** β-carotene * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-814-24-TRIENOL 44-DIMETHYL-CHOLESTA-814-24-TRIENOL] == * common-name: ** 4...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-129 CPD1F-129] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-814-24-TRIENOL 44-DIMETHYL-CHOLESTA-814-24-TRIENOL] ==
 
* common-name:
 
* common-name:
** β-carotene
+
** 4,4-dimethyl-cholesta-8,14,24-trienol
 
* smiles:
 
* smiles:
** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
+
** cc(c)=cccc([ch]1(c2(c)(c(=cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
 
* inchi-key:
 
* inchi-key:
** oenhqhleoonyie-jltxgrslsa-n
+
** lfqxezvyncbvdo-pbjlwwpksa-n
 
* molecular-weight:
 
* molecular-weight:
** 536.882
+
** 410.682
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13641]]
+
* [[RXN66-306]]
* [[RXN-8025]]
 
* [[RXN1F-152]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13641]]
+
* [[RXN3O-130]]
* [[RXN1F-151]]
+
* [[RXN66-305]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-carotene}}
+
{{#set: common-name=4,4-dimethyl-cholesta-8,14,24-trienol}}
{{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}}
+
{{#set: inchi-key=inchikey=lfqxezvyncbvdo-pbjlwwpksa-n}}
{{#set: molecular-weight=536.882}}
+
{{#set: molecular-weight=410.682}}

Revision as of 14:19, 26 August 2019

Metabolite 44-DIMETHYL-CHOLESTA-814-24-TRIENOL

  • common-name:
    • 4,4-dimethyl-cholesta-8,14,24-trienol
  • smiles:
    • cc(c)=cccc([ch]1(c2(c)(c(=cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
  • inchi-key:
    • lfqxezvyncbvdo-pbjlwwpksa-n
  • molecular-weight:
    • 410.682

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality