Difference between revisions of "CPD-13684"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE == * common-name: ** n-succinyl-l,l-2,6-diaminopimelate * smiles: ** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])...")
(Created page with "Category:metabolite == Metabolite CPD-13684 == * common-name: ** cholest-5-en-3-one * smiles: ** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34)))) * inc...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE ==
+
== Metabolite CPD-13684 ==
 
* common-name:
 
* common-name:
** n-succinyl-l,l-2,6-diaminopimelate
+
** cholest-5-en-3-one
 
* smiles:
 
* smiles:
** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
+
** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** glxuwzbupatpbr-bqbzgakwsa-l
+
** ggclnoigpmgldb-gykmgiidsa-n
 
* molecular-weight:
 
* molecular-weight:
** 288.257
+
** 384.644
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[RXN-12693]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[RXN-12693]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-succinyl-l,l-2,6-diaminopimelate}}
+
{{#set: common-name=cholest-5-en-3-one}}
{{#set: inchi-key=inchikey=glxuwzbupatpbr-bqbzgakwsa-l}}
+
{{#set: inchi-key=inchikey=ggclnoigpmgldb-gykmgiidsa-n}}
{{#set: molecular-weight=288.257}}
+
{{#set: molecular-weight=384.644}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-13684

  • common-name:
    • cholest-5-en-3-one
  • smiles:
    • cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • ggclnoigpmgldb-gykmgiidsa-n
  • molecular-weight:
    • 384.644

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality