Difference between revisions of "CPD-18379"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * smiles: ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite CPD-18379 == * common-name: ** 1-myristoylglycerol 3-phosphate * smiles: ** cccccccccccccc(=o)occ(o)cop(=o)([o-])[o-] * inchi-key: ** faz...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-METHYL-CROTONYL-COA ==
+
== Metabolite CPD-18379 ==
 
* common-name:
 
* common-name:
** 3-methylcrotonyl-coa
+
** 1-myristoylglycerol 3-phosphate
 
* smiles:
 
* smiles:
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
** cccccccccccccc(=o)occ(o)cop(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** bxipalatiynhjn-zmhdxicwsa-j
+
** fazbdrgxckpvju-mrxnpfedsa-l
 
* molecular-weight:
 
* molecular-weight:
** 845.604
+
** 380.417
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[RXN-17019]]
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+
* [[RXN-17020]]
* [[RXN-14264]]
+
* [[RXN-17021]]
 +
* [[RXN-17022]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[RXN-17017]]
* [[IVCDH]]
 
* [[RXN-11921]]
 
* [[RXN-14264]]
 
* [[RXN0-2301]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylcrotonyl-coa}}
+
{{#set: common-name=1-myristoylglycerol 3-phosphate}}
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
+
{{#set: inchi-key=inchikey=fazbdrgxckpvju-mrxnpfedsa-l}}
{{#set: molecular-weight=845.604}}
+
{{#set: molecular-weight=380.417}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-18379

  • common-name:
    • 1-myristoylglycerol 3-phosphate
  • smiles:
    • cccccccccccccc(=o)occ(o)cop(=o)([o-])[o-]
  • inchi-key:
    • fazbdrgxckpvju-mrxnpfedsa-l
  • molecular-weight:
    • 380.417

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality