Difference between revisions of "D-XYLULOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14808 == * common-name: ** scyllo-inosose * smiles: ** c1(c(c(c(c(c1o)o)=o)o)o)o * inchi-key: ** vyegbdhsghxogt-hyfglkjpsa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite D-XYLULOSE == * common-name: ** d-xylulose * smiles: ** c(o)c(o)c(o)c(=o)co * inchi-key: ** zaqjhhrnxzubte-wujlrwpwsa-n * molecular-weigh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-XYLULOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-xylulose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c(o)c(o)c(=o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zaqjhhrnxzubte-wujlrwpwsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 150.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[XYLULOKIN-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-xylulose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zaqjhhrnxzubte-wujlrwpwsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=150.131}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite D-XYLULOSE
- common-name:
- d-xylulose
- smiles:
- c(o)c(o)c(o)c(=o)co
- inchi-key:
- zaqjhhrnxzubte-wujlrwpwsa-n
- molecular-weight:
- 150.131
