Difference between revisions of "Reduced-flavodoxins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19488 == * common-name: ** 3-isopropyl-9-(methylthio)-2-oxononanoate * smiles: ** csccccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Reduced-flavodoxins == * common-name: ** a reduced flavodoxin == Reaction(s) known to consume the compound == * FLAVONADPREDUCT-RXN *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Reduced-flavodoxins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a reduced flavodoxin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[FLAVONADPREDUCT-RXN]] |
| + | * [[PYFLAVOXRE-RXN]] | ||
| + | * [[RXN-15878]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[FLAVONADPREDUCT-RXN]] |
| + | * [[PYFLAVOXRE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a reduced flavodoxin}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Reduced-flavodoxins
- common-name:
- a reduced flavodoxin
