Difference between revisions of "Cytosine2870-in-25S-rRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19395 == * common-name: ** γ-l-glutamyl-glycylglycine * smiles: ** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Cytosine2870-in-25S-rRNA == * common-name: ** a cytosine2870 in 25s rrna == Reaction(s) known to consume the compound == * RXN-15843...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Cytosine2870-in-25S-rRNA == |
* common-name: | * common-name: | ||
− | ** | + | ** a cytosine2870 in 25s rrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-15843]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a cytosine2870 in 25s rrna}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Cytosine2870-in-25S-rRNA
- common-name:
- a cytosine2870 in 25s rrna