Difference between revisions of "CPD-13533"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Phospholipids == * common-name: ** a phospholipid == Reaction(s) known to consume the compound == * 3.6.3.1-RXN == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite CPD-13533 == * common-name: ** (3r)-3-hydroxypentanoyl-coa * smiles: ** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Phospholipids ==
+
== Metabolite CPD-13533 ==
 
* common-name:
 
* common-name:
** a phospholipid
+
** (3r)-3-hydroxypentanoyl-coa
 +
* smiles:
 +
** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 +
* inchi-key:
 +
** yygypcrwzmlsgk-orumcernsa-j
 +
* molecular-weight:
 +
** 863.619
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.3.1-RXN]]
+
* [[RXN-12560]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.3.1-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a phospholipid}}
+
{{#set: common-name=(3r)-3-hydroxypentanoyl-coa}}
 +
{{#set: inchi-key=inchikey=yygypcrwzmlsgk-orumcernsa-j}}
 +
{{#set: molecular-weight=863.619}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-13533

  • common-name:
    • (3r)-3-hydroxypentanoyl-coa
  • smiles:
    • ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • yygypcrwzmlsgk-orumcernsa-j
  • molecular-weight:
    • 863.619

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality