Difference between revisions of "CPD-7064"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Lignoceroyl-ACPs == * common-name: ** a lignoceroyl-[acp] == Reaction(s) known to consume the compound == * RXN-10059 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-7064 == * common-name: ** primary fluorescent chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7064 == |
* common-name: | * common-name: | ||
| − | ** | + | ** primary fluorescent chlorophyll catabolite |
| + | * smiles: | ||
| + | ** ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)cc3(c(c)=c(c=c)c(=o)n3)))c(n4)=5)))c=o) | ||
| + | * inchi-key: | ||
| + | ** vhqsfnuihpntmw-lryvnugjsa-m | ||
| + | * molecular-weight: | ||
| + | ** 626.708 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7741]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=primary fluorescent chlorophyll catabolite}} |
| + | {{#set: inchi-key=inchikey=vhqsfnuihpntmw-lryvnugjsa-m}} | ||
| + | {{#set: molecular-weight=626.708}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-7064
- common-name:
- primary fluorescent chlorophyll catabolite
- smiles:
- ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)cc3(c(c)=c(c=c)c(=o)n3)))c(n4)=5)))c=o)
- inchi-key:
- vhqsfnuihpntmw-lryvnugjsa-m
- molecular-weight:
- 626.708
