Difference between revisions of "CPD-15924"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-321 == * common-name: ** 3-aci-nitropropanoate * smiles: ** c(cc([o-])=o)=[n+]([o-])[o-] * inchi-key: ** kxxxivrxvxkxpa-uhfffaoysa-m...")
(Created page with "Category:metabolite == Metabolite CPD-15924 == * common-name: ** 1-oleoyl-2-lyso-glycerone phosphate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o * inchi-k...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-321 ==
+
== Metabolite CPD-15924 ==
 
* common-name:
 
* common-name:
** 3-aci-nitropropanoate
+
** 1-oleoyl-2-lyso-glycerone phosphate
 
* smiles:
 
* smiles:
** c(cc([o-])=o)=[n+]([o-])[o-]
+
** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o
 
* inchi-key:
 
* inchi-key:
** kxxxivrxvxkxpa-uhfffaoysa-m
+
** yzkfnnqaebncen-ktkrtigzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 117.061
+
** 432.493
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16322]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15044]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-aci-nitropropanoate}}
+
{{#set: common-name=1-oleoyl-2-lyso-glycerone phosphate}}
{{#set: inchi-key=inchikey=kxxxivrxvxkxpa-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=yzkfnnqaebncen-ktkrtigzsa-l}}
{{#set: molecular-weight=117.061}}
+
{{#set: molecular-weight=432.493}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-15924

  • common-name:
    • 1-oleoyl-2-lyso-glycerone phosphate
  • smiles:
    • ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o
  • inchi-key:
    • yzkfnnqaebncen-ktkrtigzsa-l
  • molecular-weight:
    • 432.493

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality