Difference between revisions of "CPD-7109"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-With-N-Terminal-X-Pro == * common-name: ** a peptide with an n-terminal x-l-proline == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite CPD-7109 == * common-name: ** 4-prenylphlorisovalerophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c * inchi-key: ** lwl...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-With-N-Terminal-X-Pro ==
+
== Metabolite CPD-7109 ==
 
* common-name:
 
* common-name:
** a peptide with an n-terminal x-l-proline
+
** 4-prenylphlorisovalerophenone
 +
* smiles:
 +
** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c
 +
* inchi-key:
 +
** lwlgkghhvbvdkb-uhfffaoysa-m
 +
* molecular-weight:
 +
** 277.339
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.11.1-RXN]]
+
* [[RXN-7810]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7811]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a peptide with an n-terminal x-l-proline}}
+
{{#set: common-name=4-prenylphlorisovalerophenone}}
 +
{{#set: inchi-key=inchikey=lwlgkghhvbvdkb-uhfffaoysa-m}}
 +
{{#set: molecular-weight=277.339}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-7109

  • common-name:
    • 4-prenylphlorisovalerophenone
  • smiles:
    • cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c
  • inchi-key:
    • lwlgkghhvbvdkb-uhfffaoysa-m
  • molecular-weight:
    • 277.339

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality