Difference between revisions of "HOMO-CIT"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Triacylglycerols == * common-name: ** a triacyl-sn-glycerol == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
(Created page with "Category:metabolite == Metabolite HOMO-CIT == * common-name: ** (2r)-homocitrate * smiles: ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o * inchi-key: ** xkjvevrqmlksmo-ssdotts...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HOMO-CIT == |
* common-name: | * common-name: | ||
− | ** | + | ** (2r)-homocitrate |
+ | * smiles: | ||
+ | ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o | ||
+ | * inchi-key: | ||
+ | ** xkjvevrqmlksmo-ssdottswsa-k | ||
+ | * molecular-weight: | ||
+ | ** 203.128 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13722]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13722]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2r)-homocitrate}} |
+ | {{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}} | ||
+ | {{#set: molecular-weight=203.128}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite HOMO-CIT
- common-name:
- (2r)-homocitrate
- smiles:
- c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
- inchi-key:
- xkjvevrqmlksmo-ssdottswsa-k
- molecular-weight:
- 203.128