Difference between revisions of "4-HYDROXY-L-PROLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HX == * smiles: ** [xh] * common-name: ** hx == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...") |
(Created page with "Category:metabolite == Metabolite 4-HYDROXY-L-PROLINE == * common-name: ** trans-4-hydroxy-l-proline * smiles: ** c1([n+]c(c(=o)[o-])cc(o)1) * inchi-key: ** pmmyeevymwasqn...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-HYDROXY-L-PROLINE == |
+ | * common-name: | ||
+ | ** trans-4-hydroxy-l-proline | ||
* smiles: | * smiles: | ||
− | ** [ | + | ** c1([n+]c(c(=o)[o-])cc(o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** pmmyeevymwasqn-dmtcnviqsa-n |
+ | * molecular-weight: | ||
+ | ** 131.131 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN490-3641]] |
+ | * [[RXN66-546]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=trans-4-hydroxy-l-proline}} |
+ | {{#set: inchi-key=inchikey=pmmyeevymwasqn-dmtcnviqsa-n}} | ||
+ | {{#set: molecular-weight=131.131}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 4-HYDROXY-L-PROLINE
- common-name:
- trans-4-hydroxy-l-proline
- smiles:
- c1([n+]c(c(=o)[o-])cc(o)1)
- inchi-key:
- pmmyeevymwasqn-dmtcnviqsa-n
- molecular-weight:
- 131.131