Difference between revisions of "TRNA-Introns"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-497 == * common-name: ** pseudouridine * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2)) * inchi-key: ** ptjwiqphwpfnbw-gbndhiklsa-...") |
(Created page with "Category:metabolite == Metabolite tRNA-Introns == * common-name: ** a trna intron with a 2',3'-cyclic phosphate and a 5'-hydroxyl terminus == Reaction(s) known to consume...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-Introns == |
* common-name: | * common-name: | ||
| − | ** | + | ** a trna intron with a 2',3'-cyclic phosphate and a 5'-hydroxyl terminus |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[3.1.27.9-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trna intron with a 2',3'-cyclic phosphate and a 5'-hydroxyl terminus}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite tRNA-Introns
- common-name:
- a trna intron with a 2',3'-cyclic phosphate and a 5'-hydroxyl terminus
