Difference between revisions of "Initiation-tRNAmet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13397 == * common-name: ** l-alanyl-l-threonine * smiles: ** cc([n+])c(=o)nc(c(o)c)c([o-])=o * inchi-key: ** buqichwnxbibog-lmvfsukvs...") |
(Created page with "Category:metabolite == Metabolite Initiation-tRNAmet == * common-name: ** initiator trnamet == Reaction(s) known to consume the compound == * RXN-16165 == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Initiation-tRNAmet == |
* common-name: | * common-name: | ||
| − | ** | + | ** initiator trnamet |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16165]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=initiator trnamet}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Initiation-tRNAmet
- common-name:
- initiator trnamet
