Difference between revisions of "CPD-11411"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs == * common-name: ** a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp] == Reaction(s) known to consume t...") |
(Created page with "Category:metabolite == Metabolite CPD-11411 == * common-name: ** tetraiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11411 == |
* common-name: | * common-name: | ||
| − | ** | + | ** tetraiodothyroacetate ester glucuronide |
| + | * smiles: | ||
| + | ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(i)=c2)oc3(c=c(i)c(o)=c(i)c=3)) | ||
| + | * inchi-key: | ||
| + | ** xzmjvzbexskssm-kfyubchvsa-m | ||
| + | * molecular-weight: | ||
| + | ** 922.95 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10617]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tetraiodothyroacetate ester glucuronide}} |
| + | {{#set: inchi-key=inchikey=xzmjvzbexskssm-kfyubchvsa-m}} | ||
| + | {{#set: molecular-weight=922.95}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-11411
- common-name:
- tetraiodothyroacetate ester glucuronide
- smiles:
- c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(i)=c2)oc3(c=c(i)c(o)=c(i)c=3))
- inchi-key:
- xzmjvzbexskssm-kfyubchvsa-m
- molecular-weight:
- 922.95
