Difference between revisions of "THZ-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Branched-chain-2-keto-acid-deH-P == * common-name: ** a phosphorylated branched-chain 2-keto acid dehydrogenase == Reaction(s) known to c...") |
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * smiles: ** cc1(n=csc(ccop([o-])(=o)[o-])=1) * inchi-key: ** ocymerzcm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THZ-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methyl-5-(2-phosphooxyethyl)thiazole |
| + | * smiles: | ||
| + | ** cc1(n=csc(ccop([o-])(=o)[o-])=1) | ||
| + | * inchi-key: | ||
| + | ** ocymerzcmyjqqo-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 221.167 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[THI-P-SYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[THIAZOLSYN3-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methyl-5-(2-phosphooxyethyl)thiazole}} |
| + | {{#set: inchi-key=inchikey=ocymerzcmyjqqo-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=221.167}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite THZ-P
- common-name:
- 4-methyl-5-(2-phosphooxyethyl)thiazole
- smiles:
- cc1(n=csc(ccop([o-])(=o)[o-])=1)
- inchi-key:
- ocymerzcmyjqqo-uhfffaoysa-l
- molecular-weight:
- 221.167
