Difference between revisions of "PWY-81"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * common-name: ** phytenal * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=c[ch...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] ==
 
* common-name:
 
* common-name:
** phytenal
+
** β-d-glucopyranose
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o
+
** c(o)c1(oc(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** rafzysuicbqabu-pyddkjgssa-n
+
** wqzgkkkjijffok-vfuothlcsa-n
 
* molecular-weight:
 
* molecular-weight:
** 294.52
+
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-479]]
+
* [[ALDOSE-1-EPIMERASE-RXN]]
 +
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-478]]
+
* [[3.2.1.106-RXN]]
 +
* [[ALDOSE-1-EPIMERASE-RXN]]
 +
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
 +
* [[TREHALA-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytenal}}
+
{{#set: common-name=β-d-glucopyranose}}
{{#set: inchi-key=inchikey=rafzysuicbqabu-pyddkjgssa-n}}
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-vfuothlcsa-n}}
{{#set: molecular-weight=294.52}}
+
{{#set: molecular-weight=180.157}}

Revision as of 14:19, 26 August 2019

Metabolite GLC

  • common-name:
    • β-d-glucopyranose
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • wqzgkkkjijffok-vfuothlcsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality