Difference between revisions of "Heparan-NAc-Glc"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CMP == * common-name: ** cmp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o * inchi-key: ** ierhlvcpsmictf-xvfcmesi...")
(Created page with "Category:metabolite == Metabolite Heparan-NAc-Glc == * common-name: ** a [heparan]-n-acetyl-α-d-glucosamine == Reaction(s) known to consume the compound == == Reacti...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CMP ==
+
== Metabolite Heparan-NAc-Glc ==
 
* common-name:
 
* common-name:
** cmp
+
** a [heparan]-n-acetyl-α-d-glucosamine
* smiles:
 
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o
 
* inchi-key:
 
** ierhlvcpsmictf-xvfcmesisa-l
 
* molecular-weight:
 
** 321.183
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATCM]]
 
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
 
* [[PHOSPHASERSYN-RXN]]
 
* [[RXN-11832]]
 
* [[RXN-14026]]
 
* [[RXN-5781]]
 
* [[RXN-9614]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[3.1.6.14-RXN]]
* [[2.7.8.11-RXN]]
 
* [[ATCY]]
 
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
 
* [[DATCY]]
 
* [[DCTCP]]
 
* [[DGTCY]]
 
* [[DTTGY]]
 
* [[DUTCP]]
 
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 
* [[GTCY]]
 
* [[ITCY]]
 
* [[P-PANTOCYSLIG-RXN]]
 
* [[PHOSPHAGLYPSYN-RXN]]
 
* [[PHOSPHASERSYN-RXN]]
 
* [[RXN-12198]]
 
* [[RXN-12200]]
 
* [[RXN-17731]]
 
* [[RXN-17733]]
 
* [[RXN-5781]]
 
* [[RXN-8141]]
 
* [[RXN-9614]]
 
* [[RXN0-302]]
 
* [[RXN0-383]]
 
* [[RXN66-578]]
 
* [[UTCY]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cmp}}
+
{{#set: common-name=a [heparan]-n-acetyl-&alpha;-d-glucosamine}}
{{#set: inchi-key=inchikey=ierhlvcpsmictf-xvfcmesisa-l}}
 
{{#set: molecular-weight=321.183}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Heparan-NAc-Glc

  • common-name:
    • a [heparan]-n-acetyl-α-d-glucosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [heparan]-n-acetyl-α-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.