Difference between revisions of "CPD-13122"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15677 == * common-name: ** 4-trans-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...") |
(Created page with "Category:metabolite == Metabolite CPD-13122 == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o * inchi-key: ** iakkjsv...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-13122 == |
* common-name: | * common-name: | ||
− | ** 4- | + | ** 4-deoxy-l-threo-hex-4-enopyranuronate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** iakkjsvsfctlry-baktxgbysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 175.118 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-16512]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12177]] |
+ | * [[RXN-12178]] | ||
+ | * [[RXN-12270]] | ||
+ | * [[RXN-16485]] | ||
+ | * [[RXN-16512]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=4- | + | {{#set: common-name=4-deoxy-l-threo-hex-4-enopyranuronate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iakkjsvsfctlry-baktxgbysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=175.118}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13122
- common-name:
- 4-deoxy-l-threo-hex-4-enopyranuronate
- smiles:
- c(c1(oc(c(c(c=1)o)o)o))([o-])=o
- inchi-key:
- iakkjsvsfctlry-baktxgbysa-m
- molecular-weight:
- 175.118