Difference between revisions of "CPD0-1308"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12482 == * common-name: ** 3,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2)) * inchi-key: ** hmlzlhkhnblljd-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite CPD0-1308 == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o * inchi-key: ** xddaorkbjwwyjs-uhfffaoysa-l * molecular...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-1308 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glyphosate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(ncc(=o)[o-])p(o)([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xddaorkbjwwyjs-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 167.058 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17951]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glyphosate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xddaorkbjwwyjs-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=167.058}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD0-1308
- common-name:
- glyphosate
- smiles:
- c(ncc(=o)[o-])p(o)([o-])=o
- inchi-key:
- xddaorkbjwwyjs-uhfffaoysa-l
- molecular-weight:
- 167.058
