Difference between revisions of "PYRAZINAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] * inchi-key: ** bzqfbwgglxlepq-reohcl...") |
(Created page with "Category:metabolite == Metabolite PYRAZINAMIDE == * common-name: ** pyrazinamide * smiles: ** c1(n=cc=nc=1c(=o)n) * inchi-key: ** ipehbumcgvemrf-uhfffaoysa-n * molecular-w...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PYRAZINAMIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** pyrazinamide |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(n=cc=nc=1c(=o)n) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ipehbumcgvemrf-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 123.114 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PYRAZIN-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pyrazinamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ipehbumcgvemrf-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=123.114}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite PYRAZINAMIDE
- common-name:
- pyrazinamide
- smiles:
- c1(n=cc=nc=1c(=o)n)
- inchi-key:
- ipehbumcgvemrf-uhfffaoysa-n
- molecular-weight:
- 123.114
