Difference between revisions of "D-MYO-INOSITOL-13-BISPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLYCERATE == * common-name: ** d-glycerate * smiles: ** c(=o)([o-])c(o)co * inchi-key: ** rbnpomfgqqghho-uwtatzphsa-m * molecular-weight:...")
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-13-BISPHOSPHATE == * common-name: ** d-myo-inositol (1,3)-bisphosphate * smiles: ** c1(o)(c(o)c(op([o-])([o-])=o)c(o)c(op(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLYCERATE ==
+
== Metabolite D-MYO-INOSITOL-13-BISPHOSPHATE ==
 
* common-name:
 
* common-name:
** d-glycerate
+
** d-myo-inositol (1,3)-bisphosphate
 
* smiles:
 
* smiles:
** c(=o)([o-])c(o)co
+
** c1(o)(c(o)c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(o)1)
 
* inchi-key:
 
* inchi-key:
** rbnpomfgqqghho-uwtatzphsa-m
+
** puvhmwjjtitugo-ficorbcrsa-j
 
* molecular-weight:
 
* molecular-weight:
** 105.07
+
** 336.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLY3KIN-RXN]]
 
* [[HYDROXYPYRUVATE-REDUCTASE-RXN]]
 
* [[RXN-15115]]
 
* [[RXN0-5289]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HYDROXYPYRUVATE-REDUCTASE-RXN]]
+
* [[RXN-10959]]
* [[RXN-15115]]
 
* [[RXN0-5289]]
 
* [[TSA-REDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glycerate}}
+
{{#set: common-name=d-myo-inositol (1,3)-bisphosphate}}
{{#set: inchi-key=inchikey=rbnpomfgqqghho-uwtatzphsa-m}}
+
{{#set: inchi-key=inchikey=puvhmwjjtitugo-ficorbcrsa-j}}
{{#set: molecular-weight=105.07}}
+
{{#set: molecular-weight=336.085}}

Latest revision as of 11:17, 18 March 2021

Metabolite D-MYO-INOSITOL-13-BISPHOSPHATE

  • common-name:
    • d-myo-inositol (1,3)-bisphosphate
  • smiles:
    • c1(o)(c(o)c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • puvhmwjjtitugo-ficorbcrsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality