Difference between revisions of "Cytidine4-tRNAGly-GCC"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GUANOSINE == * common-name: ** guanosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** nyhbqmygnkiuif-uuo...") |
(Created page with "Category:metabolite == Metabolite Cytidine4-tRNAGly-GCC == * common-name: ** a cytidine4 in trnagly == Reaction(s) known to consume the compound == * RXN-12478 == Reac...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Cytidine4-tRNAGly-GCC == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cytidine4 in trnagly |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12478]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cytidine4 in trnagly}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Cytidine4-tRNAGly-GCC
- common-name:
- a cytidine4 in trnagly
