Difference between revisions of "CPD-19010"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14875 == * common-name: ** grixazone b * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3))) * inchi...") |
(Created page with "Category:metabolite == Metabolite CPD-19010 == * common-name: ** 1,2-epoxy-2-methylpropane * smiles: ** cc1(c)(oc1) * inchi-key: ** gelkghvafrcjna-uhfffaoysa-n * molecular...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-19010 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1,2-epoxy-2-methylpropane |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c)(oc1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gelkghvafrcjna-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 72.107 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17589]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1,2-epoxy-2-methylpropane}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gelkghvafrcjna-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=72.107}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-19010
- common-name:
- 1,2-epoxy-2-methylpropane
- smiles:
- cc1(c)(oc1)
- inchi-key:
- gelkghvafrcjna-uhfffaoysa-n
- molecular-weight:
- 72.107
