Difference between revisions of "PWY-7407"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfamates Sulfamates] == * common-name: ** a sulfamate == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] == * common-name: ** (indol-3-yl)acetate * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (indol-3-yl)acetate |
| + | * smiles: | ||
| + | ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) | ||
| + | * inchi-key: | ||
| + | ** seovtrfcigrimh-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 174.179 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10711]] |
| + | * [[RXN-10715]] | ||
| + | * [[RXN-1404]] | ||
| + | * [[RXN-5581]] | ||
| + | * [[RXNDQC-2]] | ||
| + | * [[RXNN-404]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(indol-3-yl)acetate}} |
| + | {{#set: inchi-key=inchikey=seovtrfcigrimh-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=174.179}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite INDOLE_ACETATE_AUXIN
- common-name:
- (indol-3-yl)acetate
- smiles:
- c([o-])(=o)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- seovtrfcigrimh-uhfffaoysa-m
- molecular-weight:
- 174.179
