Difference between revisions of "PWY-6984"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LL-DIAMINOPIMELATE LL-DIAMINOPIMELATE] == * common-name: ** l,l-diaminopimelate * smiles: ** c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13689 CPD-13689] == * common-name: ** (25s)-3-oxocholest-4-en-26-oate * smiles: ** cc(cccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LL-DIAMINOPIMELATE LL-DIAMINOPIMELATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13689 CPD-13689] ==
 
* common-name:
 
* common-name:
** l,l-diaminopimelate
+
** (25s)-3-oxocholest-4-en-26-oate
 
* smiles:
 
* smiles:
** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
+
** cc(cccc(c(=o)[o-])c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** gmkmezvlhjarhf-whfbiakzsa-n
+
** psxqjzdfwdkbip-kmppvsslsa-m
 
* molecular-weight:
 
* molecular-weight:
** 190.199
+
** 413.619
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIAMINOPIMEPIM-RXN]]
 
* [[RXN-7737]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIAMINOPIMEPIM-RXN]]
+
* [[RXN-12849]]
* [[RXN-7737]]
+
* [[RXN-17644]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l,l-diaminopimelate}}
+
{{#set: common-name=(25s)-3-oxocholest-4-en-26-oate}}
{{#set: inchi-key=inchikey=gmkmezvlhjarhf-whfbiakzsa-n}}
+
{{#set: inchi-key=inchikey=psxqjzdfwdkbip-kmppvsslsa-m}}
{{#set: molecular-weight=190.199}}
+
{{#set: molecular-weight=413.619}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-13689

  • common-name:
    • (25s)-3-oxocholest-4-en-26-oate
  • smiles:
    • cc(cccc(c(=o)[o-])c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • psxqjzdfwdkbip-kmppvsslsa-m
  • molecular-weight:
    • 413.619

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality