Difference between revisions of "PWY-7917"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUPER-OXIDE SUPER-OXIDE] == * common-name: ** superoxide * smiles: ** [o-]o * inchi-key: ** ouu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUPER-OXIDE SUPER-OXIDE] ==
 
* common-name:
 
* common-name:
** trans-dienelactone
+
** superoxide
 
* smiles:
 
* smiles:
** c1(=cc(=o)oc(=cc(=o)[o-])1)
+
** [o-]o
 
* inchi-key:
 
* inchi-key:
** ayfxpgxazmfwnh-onegzznksa-m
+
** ouuqczgpvncoij-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 139.087
+
** 31.999
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9868]]
+
* [[SUPEROX-DISMUT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12615]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-dienelactone}}
+
{{#set: common-name=superoxide}}
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}}
+
{{#set: inchi-key=inchikey=ouuqczgpvncoij-uhfffaoysa-m}}
{{#set: molecular-weight=139.087}}
+
{{#set: molecular-weight=31.999}}

Revision as of 14:19, 26 August 2019

Metabolite SUPER-OXIDE

  • common-name:
    • superoxide
  • smiles:
    • [o-]o
  • inchi-key:
    • ouuqczgpvncoij-uhfffaoysa-m
  • molecular-weight:
    • 31.999

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality