Difference between revisions of "ASPASN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15687 CPD-15687] == * common-name: ** 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa * smiles: *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Prime-OH-Terminated-RNAs 3Prime-OH-Terminated-RNAs] == * common-name: ** an [rna]-3'-hydroxyl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15687 CPD-15687] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Prime-OH-Terminated-RNAs 3Prime-OH-Terminated-RNAs] ==
 
* common-name:
 
* common-name:
** 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa
+
** an [rna]-3'-hydroxyl
* smiles:
 
** ccccccc=cc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** njxbfcfhvuiemz-qtjplklfsa-j
 
* molecular-weight:
 
** 983.813
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14799]]
+
* [[RNA-LIGASE-ATP-RXN]]
 +
* [[RXN-17927]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-cis, 7-trans-3-oxo-tetradecadienoyl-coa}}
+
{{#set: common-name=an [rna]-3'-hydroxyl}}
{{#set: inchi-key=inchikey=njxbfcfhvuiemz-qtjplklfsa-j}}
 
{{#set: molecular-weight=983.813}}
 

Revision as of 14:19, 26 August 2019

Metabolite 3Prime-OH-Terminated-RNAs

  • common-name:
    • an [rna]-3'-hydroxyl

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [rna]-3'-hydroxyl" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.