Difference between revisions of "PWY-7888"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-sulfate-D-GlcNS Heparan-sulfate-D-GlcNS] == * common-name: ** a [heparan sulfate]-&alph...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-sulfate-D-GlcNS Heparan-sulfate-D-GlcNS] ==
 
* common-name:
 
* common-name:
** datp
+
** a [heparan sulfate]-α-d-n-sulfoglucosamine
* smiles:
 
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
** suyvubyjarfzho-rrkcrqdmsa-j
 
* molecular-weight:
 
** 487.152
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DATCY]]
+
* [[2.8.2.23-RXN]]
* [[DATPtm]]
+
* [[2.8.2.29-RXN]]
* [[DATUP]]
 
* [[RXN-14195]]
 
* [[RXN-14214]]
 
* [[RXN0-384]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DADPKIN-RXN]]
+
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
* [[DATPtm]]
 
* [[NDPK]]
 
* [[NDPKm]]
 
* [[RXN-14192]]
 
* [[RXN0-745]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=datp}}
+
{{#set: common-name=a [heparan sulfate]-α-d-n-sulfoglucosamine}}
{{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}}
 
{{#set: molecular-weight=487.152}}
 

Revision as of 14:19, 26 August 2019

Metabolite Heparan-sulfate-D-GlcNS

  • common-name:
    • a [heparan sulfate]-α-d-n-sulfoglucosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [heparan sulfate]-α-d-n-sulfoglucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.