Difference between revisions of "PWY-6054"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9872 CPD-9872] == * common-name: ** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquin...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-SEC-tRNAs Charged-SEC-tRNAs] == * common-name: ** an l-selenocysteinyl-[trnasec] == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9872 CPD-9872] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-SEC-tRNAs Charged-SEC-tRNAs] ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol
+
** an l-selenocysteinyl-[trnasec]
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** glnrsjsltucxtp-iqsnhbbhsa-n
 
* molecular-weight:
 
** 767.229
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9242]]
+
* [[RXN-10039]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=an l-selenocysteinyl-[trnasec]}}
{{#set: inchi-key=inchikey=glnrsjsltucxtp-iqsnhbbhsa-n}}
 
{{#set: molecular-weight=767.229}}
 

Revision as of 14:19, 26 August 2019

Metabolite Charged-SEC-tRNAs

  • common-name:
    • an l-selenocysteinyl-[trnasec]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-selenocysteinyl-[trnasec" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.