Difference between revisions of "PWY-7616"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14133 CPD-14133] == * common-name: ** (r)-nadphx * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Relaxed-DNAs Relaxed-DNAs] == * common-name: ** a relaxed dna == Reaction(s) known to consume t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14133 CPD-14133] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Relaxed-DNAs Relaxed-DNAs] ==
 
* common-name:
 
* common-name:
** (r)-nadphx
+
** a relaxed dna
* smiles:
 
** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
 
* inchi-key:
 
** szkxtjuokargiy-mtkbybfrsa-j
 
* molecular-weight:
 
** 759.41
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13142]]
+
* [[5.99.1.2-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[5.99.1.2-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-nadphx}}
+
{{#set: common-name=a relaxed dna}}
{{#set: inchi-key=inchikey=szkxtjuokargiy-mtkbybfrsa-j}}
 
{{#set: molecular-weight=759.41}}
 

Revision as of 14:19, 26 August 2019

Metabolite Relaxed-DNAs

  • common-name:
    • a relaxed dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality