Difference between revisions of "PWY-5663"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-ETHANOLAMINE CDP-ETHANOLAMINE] == * common-name: ** cdp-ethanolamine * smiles: ** c(cop(op(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1084 CPD-1084] == * common-name: ** perillyl aldehyde == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-ETHANOLAMINE CDP-ETHANOLAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1084 CPD-1084] ==
 
* common-name:
 
* common-name:
** cdp-ethanolamine
+
** perillyl aldehyde
* smiles:
 
** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
 
* inchi-key:
 
** wvimueuqjfpndk-pebgctimsa-m
 
* molecular-weight:
 
** 445.239
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
+
* [[RXN-14280]]
* [[RXN-17731]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.14-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cdp-ethanolamine}}
+
{{#set: common-name=perillyl aldehyde}}
{{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}}
 
{{#set: molecular-weight=445.239}}
 

Revision as of 14:19, 26 August 2019

Metabolite CPD-1084

  • common-name:
    • perillyl aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality