Difference between revisions of "BGALACT-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMATE CARBAMATE] == * common-name: ** carbamate * smiles: ** c(=o)([o-])n * inchi-key: ** k...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * common-name: ** (+)-taxifolin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (+)-taxifolin |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cxqwrcvtcmqvqx-lsdhhaiusa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 303.248 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-527]] |
| + | * [[RXN-600]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7775]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(+)-taxifolin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cxqwrcvtcmqvqx-lsdhhaiusa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=303.248}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-474
- common-name:
- (+)-taxifolin
- smiles:
- c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
- inchi-key:
- cxqwrcvtcmqvqx-lsdhhaiusa-m
- molecular-weight:
- 303.248
