Difference between revisions of "PWY-7591"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-phospho-ribulosamines Protein-phospho-ribulosamines] == * common-name: ** a [protein]-n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] == * common-name: ** 3-demethylubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-phospho-ribulosamines Protein-phospho-ribulosamines] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] ==
 
* common-name:
 
* common-name:
** a [protein]-n6-(3-o-phospho-d-ribulosyl)-l-lysine
+
** 3-demethylubiquinol-10
 +
* smiles:
 +
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
 +
* inchi-key:
 +
** vlmqnhnmqvlpqi-avrcvibksa-n
 +
* molecular-weight:
 +
** 851.347
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12003]]
+
* [[RXN-9237]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12003]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-n6-(3-o-phospho-d-ribulosyl)-l-lysine}}
+
{{#set: common-name=3-demethylubiquinol-10}}
 +
{{#set: inchi-key=inchikey=vlmqnhnmqvlpqi-avrcvibksa-n}}
 +
{{#set: molecular-weight=851.347}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-9873

  • common-name:
    • 3-demethylubiquinol-10
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
  • inchi-key:
    • vlmqnhnmqvlpqi-avrcvibksa-n
  • molecular-weight:
    • 851.347

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality