Difference between revisions of "TREHALOSESYN-PWY"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METOH METOH] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P] ==
 * common-name:
-** methanol
+** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
 * smiles:
-** co
+** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)
 * inchi-key:
-** okkjlvbelutlkv-uhfffaoysa-n
+** qkmbynrmprkvto-mnovxskesa-k
 * molecular-weight:
-** 32.042
+** 346.21
 == Reaction(s) known to consume the compound ==
-* [[METHANOL-DEHYDROGENASE-RXN]]
+* [[IGPSYN-RXN]]
-* [[RXN-14189]]
 == Reaction(s) known to produce the compound ==
-* [[METHANOL-DEHYDROGENASE-RXN]]
+* [[PRAISOM-RXN]]
-* [[RXN-10711]]
-* [[RXN-10767]]
-* [[RXN-12322]]
-* [[RXN-15776]]
-* [[RXN-8409]]
-* [[RXNQT-4366]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=methanol}}
+{{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}}
-{{#set: inchi-key=inchikey=okkjlvbelutlkv-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}}
-{{#set: molecular-weight=32.042}}
+{{#set: molecular-weight=346.21}}