Difference between revisions of "SJ08247"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine Protein-L-methionine] == * common-name: ** a [protein]-l-methionine == Rea...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * common-name: ** 3-[(5'-methylthio)pentyl]malate * smiles: ** cscccccc(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-[(5'-methylthio)pentyl]malate |
+ | * smiles: | ||
+ | ** cscccccc(c(o)c(=o)[o-])c(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** ybisuhxejdgadq-uhfffaoysa-l | ||
+ | * molecular-weight: | ||
+ | ** 248.293 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-18204]] |
+ | * [[RXNQT-4171]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-18204]] | |
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-[(5'-methylthio)pentyl]malate}} |
+ | {{#set: inchi-key=inchikey=ybisuhxejdgadq-uhfffaoysa-l}} | ||
+ | {{#set: molecular-weight=248.293}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPDQT-38
- common-name:
- 3-[(5'-methylthio)pentyl]malate
- smiles:
- cscccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- ybisuhxejdgadq-uhfffaoysa-l
- molecular-weight:
- 248.293
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(5'-methylthio)pentyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.