Difference between revisions of "SJ02165"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == * common-name: ** (2e,11z)-hexadec-2,11-dienoyl-coa * smiles: ** ccccc=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] ==
 
* common-name:
 
* common-name:
** (2e,11z)-hexadec-2,11-dienoyl-coa
+
** 2-methyl-6-phytyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+
** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
 
* inchi-key:
 
* inchi-key:
** amssmxhtrodksm-fyyfncousa-j
+
** gtwcnyrfozkwtl-uofxaseasa-n
 
* molecular-weight:
 
* molecular-weight:
** 997.883
+
** 402.659
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16558]]
+
* [[RXN-2542]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-2541]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,11z)-hexadec-2,11-dienoyl-coa}}
+
{{#set: common-name=2-methyl-6-phytyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=amssmxhtrodksm-fyyfncousa-j}}
+
{{#set: inchi-key=inchikey=gtwcnyrfozkwtl-uofxaseasa-n}}
{{#set: molecular-weight=997.883}}
+
{{#set: molecular-weight=402.659}}

Revision as of 14:19, 26 August 2019

Metabolite MPBQ

  • common-name:
    • 2-methyl-6-phytyl-1,4-benzoquinol
  • smiles:
    • cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
  • inchi-key:
    • gtwcnyrfozkwtl-uofxaseasa-n
  • molecular-weight:
    • 402.659

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality