Difference between revisions of "SJ05645"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SELENOHOMOCYSTEINE SELENOHOMOCYSTEINE] == * common-name: ** seleno-l-homocysteine * smiles: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * common-name: ** apigenin * smiles: ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == |
* common-name: | * common-name: | ||
| − | ** | + | ** apigenin |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kznifhplkgyrtm-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 269.233 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7651]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=apigenin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kznifhplkgyrtm-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=269.233}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-431
- common-name:
- apigenin
- smiles:
- c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3)))
- inchi-key:
- kznifhplkgyrtm-uhfffaoysa-m
- molecular-weight:
- 269.233
