Difference between revisions of "SJ12800"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYCYTIDINE DEOXYCYTIDINE] == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Sec tRNA-Sec] == * common-name: ** a trnasec == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYCYTIDINE DEOXYCYTIDINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Sec tRNA-Sec] ==
 
* common-name:
 
* common-name:
** 2'-deoxycytidine
+
** a trnasec
* smiles:
 
** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2))
 
* inchi-key:
 
** cktsbutuhbmzgz-shyzeuofsa-n
 
* molecular-weight:
 
** 227.219
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYTIDEAM-RXN]]
+
* [[RXN0-2161]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-deoxycytidine}}
+
{{#set: common-name=a trnasec}}
{{#set: inchi-key=inchikey=cktsbutuhbmzgz-shyzeuofsa-n}}
 
{{#set: molecular-weight=227.219}}
 

Revision as of 14:19, 26 August 2019

Metabolite tRNA-Sec

  • common-name:
    • a trnasec

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality