Difference between revisions of "SJ22407"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Rhodopsins Rhodopsins] == * common-name: ** a rhodopsin == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15368 CPD-15368] == * common-name: ** 3-oxo-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=cccc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15368 CPD-15368] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxo-lesqueroloyl-coa |
+ | * smiles: | ||
+ | ** ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | ||
+ | * inchi-key: | ||
+ | ** nqxrrzbozbkgiu-mhaufedzsa-j | ||
+ | * molecular-weight: | ||
+ | ** 1085.989 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14493]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14492]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxo-lesqueroloyl-coa}} |
+ | {{#set: inchi-key=inchikey=nqxrrzbozbkgiu-mhaufedzsa-j}} | ||
+ | {{#set: molecular-weight=1085.989}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-15368
- common-name:
- 3-oxo-lesqueroloyl-coa
- smiles:
- ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- nqxrrzbozbkgiu-mhaufedzsa-j
- molecular-weight:
- 1085.989