Difference between revisions of "SJ05262"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] ==
 
* common-name:
 
* common-name:
** keto-phenylpyruvate
+
** sinapoyl-coa
 
* smiles:
 
* smiles:
** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** btnmpgbkdvtsjy-uhfffaoysa-m
+
** rbfuwesmwrugfy-gsnioflcsa-j
 
* molecular-weight:
 
* molecular-weight:
** 163.152
+
** 969.7
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.64-RXN]]
+
* [[RXN-1124]]
* [[PHEAMINOTRANS-RXN]]
 
* [[PREPHENATEDEHYDRAT-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-10815]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.64-RXN]]
+
* [[RXN-10919]]
* [[PHEAMINOTRANS-RXN]]
+
* [[RXN-1124]]
* [[PPDH]]
 
* [[PREPHENATEDEHYDRAT-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-17130]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=keto-phenylpyruvate}}
+
{{#set: common-name=sinapoyl-coa}}
{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}}
{{#set: molecular-weight=163.152}}
+
{{#set: molecular-weight=969.7}}

Revision as of 14:19, 26 August 2019

Metabolite SINAPOYL-COA

  • common-name:
    • sinapoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • rbfuwesmwrugfy-gsnioflcsa-j
  • molecular-weight:
    • 969.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality