Difference between revisions of "SJ17513"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9854 CPD-9854] == * common-name: ** 3-(all-trans-heptaprenyl)benzene-1,2-diol * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOAMIDE LIPOAMIDE] == * common-name: ** lipoamide * smiles: ** c1(cc(ccccc(n)=o)ss1) * inchi-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9854 CPD-9854] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOAMIDE LIPOAMIDE] ==
 
* common-name:
 
* common-name:
** 3-(all-trans-heptaprenyl)benzene-1,2-diol
+
** lipoamide
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
+
** c1(cc(ccccc(n)=o)ss1)
 
* inchi-key:
 
* inchi-key:
** ooykexozubwosx-nfdzfspwsa-n
+
** fccddurtiiuxby-ssdottswsa-n
 
* molecular-weight:
 
* molecular-weight:
** 586.94
+
** 205.333
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9225]]
+
* [[AKGDHmi]]
 +
* [[PDHam2hi]]
 +
* [[PDHam2mi]]
 +
* [[PDHe3mr]]
 +
* [[RXN-18331]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PDHe3mr]]
 +
* [[RXN-18331]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(all-trans-heptaprenyl)benzene-1,2-diol}}
+
{{#set: common-name=lipoamide}}
{{#set: inchi-key=inchikey=ooykexozubwosx-nfdzfspwsa-n}}
+
{{#set: inchi-key=inchikey=fccddurtiiuxby-ssdottswsa-n}}
{{#set: molecular-weight=586.94}}
+
{{#set: molecular-weight=205.333}}

Revision as of 14:19, 26 August 2019

Metabolite LIPOAMIDE

  • common-name:
    • lipoamide
  • smiles:
    • c1(cc(ccccc(n)=o)ss1)
  • inchi-key:
    • fccddurtiiuxby-ssdottswsa-n
  • molecular-weight:
    • 205.333

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality