Difference between revisions of "SJ21020"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * common-name: ** s-sulfanylglutathione * smiles: ** c(ss)c(c(ncc([o-])...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-seryl-Protein L-methionyl-L-seryl-Protein] == * common-name: ** an n-terminal-l-m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-seryl-Protein L-methionyl-L-seryl-Protein] ==
 
* common-name:
 
* common-name:
** s-sulfanylglutathione
+
** an n-terminal-l-methionyl-l-seryl-[protein]
* smiles:
 
** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
** qbolvlbsugjhgb-wdskdsinsa-m
 
* molecular-weight:
 
** 338.373
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FESGSHTHIO-RXN]]
+
* [[RXN-17876]]
* [[RXN-13161]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-sulfanylglutathione}}
+
{{#set: common-name=an n-terminal-l-methionyl-l-seryl-[protein]}}
{{#set: inchi-key=inchikey=qbolvlbsugjhgb-wdskdsinsa-m}}
 
{{#set: molecular-weight=338.373}}
 

Revision as of 14:19, 26 August 2019

Metabolite L-methionyl-L-seryl-Protein

  • common-name:
    • an n-terminal-l-methionyl-l-seryl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal-l-methionyl-l-seryl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.