Difference between revisions of "SJ04338"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9861 CPD-9861] == * common-name: ** 3-demethylubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Bleomycins Bleomycins] == * common-name: ** a bleomycin == Reaction(s) known to consume the com...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9861 CPD-9861] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Bleomycins Bleomycins] ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-7
+
** a bleomycin
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
 
* inchi-key:
 
** ohbhbmxnjcumcr-dkccahehsa-n
 
* molecular-weight:
 
** 646.992
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9229]]
+
* [[3.4.22.40-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-7}}
+
{{#set: common-name=a bleomycin}}
{{#set: inchi-key=inchikey=ohbhbmxnjcumcr-dkccahehsa-n}}
 
{{#set: molecular-weight=646.992}}
 

Revision as of 14:19, 26 August 2019

Metabolite Bleomycins

  • common-name:
    • a bleomycin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality